C35H37N3O6 — CID 10348490
N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-methyl-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10348490) has the molecular formula C35H37N3O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-methyl-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-methyl-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10348490 |
| Molecular Formula | C35H37N3O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-5-methyl-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1cc(OCCCN(C)Cc2ccc(OC)c(OC)c2)ccc1NC(=O)c1cccc2c(=O)c3cccc(C)c3[nH]c12 |
| InChI | InChI=1S/C35H37N3O6/c1-22-9-6-10-25-32(22)37-33-26(34(25)39)11-7-12-27(33)35(40)36-28-15-14-24(20-30(28)42-4)44-18-8-17-38(2)21-23-13-16-29(41-3)31(19-23)43-5/h6-7,9-16,19-20H,8,17-18,21H2,1-5H3,(H,36,40)(H,37,39) |
| InChIKey | UHHUHTIYOANXHB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|