C16H26N2O2S — CID 103485947
ethyl 3-[2-(cyclooctylamino)-1,3-thiazol-4-yl]propanoate (PubChem CID 103485947) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is ethyl 3-[2-(cyclooctylamino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(cyclooctylamino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103485947 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethyl 3-[2-(cyclooctylamino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(NC2CCCCCCC2)n1 |
| InChI | InChI=1S/C16H26N2O2S/c1-2-20-15(19)11-10-14-12-21-16(18-14)17-13-8-6-4-3-5-7-9-13/h12-13H,2-11H2,1H3,(H,17,18) |
| InChIKey | WDGQEZCVRJGABK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |