C36H27F3N2O4 — CID 10348731
(E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide (PubChem CID 10348731) has the molecular formula C36H27F3N2O4 and a molecular weight of 608.62 g/mol. Its IUPAC name is (E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 10348731 |
| Molecular Formula | C36H27F3N2O4 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | (E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NC(=O)/C=C/c3ccc(-c4ccc(C(F)(F)F)cc4)o3)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H27F3N2O4/c1-23-7-9-24(10-8-23)21-34(43)41-31-18-15-28(22-30(31)35(44)26-5-3-2-4-6-26)40-33(42)20-17-29-16-19-32(45-29)25-11-13-27(14-12-25)36(37,38)39/h2-20,22H,21H2,1H3,(H,40,42)(H,41,43)/b20-17+ |
| InChIKey | YTFDSYXPFSBFSA-LVZFUZTISA-N |
| XLogP | 8.34 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|