About 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide
2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103488578) has the molecular formula C9H17F3N2O3
and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| PubChem CID | 103488578 |
| Molecular Formula | C9H17F3N2O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CCOCC(C)OCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O3/c1-3-16-4-6(2)17-5-7(8(13)14-15)9(10,11)12/h6-7,15H,3-5H2,1-2H3,(H2,13,14) |
| InChIKey | HQKHDBGZUDDECA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The IUPAC name of 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide (CID 103488578) is 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The canonical SMILES for 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide is CCOCC(C)OCC(C(N)=NO)C(F)(F)F.
What is the InChIKey of 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The InChIKey is HQKHDBGZUDDECA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O3/c1-3-16-4-6(2)17-5-7(8(13)14-15)9(10,11)12/h6-7,15H,3-5H2,1-2H3,(H2,13,14).
What are the key properties of 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide?
2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide has a molecular weight of 258.24 g/mol, XLogP of 1.35, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethoxypropan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide is sourced from PubChem (CID 103488578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).