C35H48F3NO5 — CID 10348910
tert-butyl (2S,3S,5R)-2-benzyl-5-nonyl-3-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxypyrrolidine-1-carboxylate (PubChem CID 10348910) has the molecular formula C35H48F3NO5 and a molecular weight of 619.77 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R)-2-benzyl-5-nonyl-3-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,5R)-2-benzyl-5-nonyl-3-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10348910 |
| Molecular Formula | C35H48F3NO5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.35 |
| IUPAC Name | tert-butyl (2S,3S,5R)-2-benzyl-5-nonyl-3-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxypyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1C[C@H](OC(=O)C(OC)(c2ccccc2)C(F)(F)F)[C@H](Cc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H48F3NO5/c1-6-7-8-9-10-11-18-23-28-25-30(43-31(40)34(42-5,35(36,37)38)27-21-16-13-17-22-27)29(24-26-19-14-12-15-20-26)39(28)32(41)44-33(2,3)4/h12-17,19-22,28-30H,6-11,18,23-25H2,1-5H3/t28-,29+,30+,34?/m1/s1 |
| InChIKey | CVGUXBVWHYPSGV-RTQFTORMSA-N |
| XLogP | 8.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|