C15H24BrNO2 — CID 103490191
2-(2-bromophenyl)-2-(1-ethoxypropan-2-yloxy)-N-ethylethanamine (PubChem CID 103490191) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-(1-ethoxypropan-2-yloxy)-N-ethylethanamine.
| Compound Name | 2-(2-bromophenyl)-2-(1-ethoxypropan-2-yloxy)-N-ethylethanamine |
|---|---|
| PubChem CID | 103490191 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-(2-bromophenyl)-2-(1-ethoxypropan-2-yloxy)-N-ethylethanamine |
| SMILES | CCNCC(OC(C)COCC)c1ccccc1Br |
| InChI | InChI=1S/C15H24BrNO2/c1-4-17-10-15(19-12(3)11-18-5-2)13-8-6-7-9-14(13)16/h6-9,12,15,17H,4-5,10-11H2,1-3H3 |
| InChIKey | SUQAWQJBAFGHFU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |