C39H34ClN3O3 — CID 10349022
[(2-chloro-10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(5-methyl-1-tritylimidazol-4-yl)methyl] acetate (PubChem CID 10349022) has the molecular formula C39H34ClN3O3 and a molecular weight of 628.17 g/mol. Its IUPAC name is [(2-chloro-10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(5-methyl-1-tritylimidazol-4-yl)methyl] acetate.
| Compound Name | [(2-chloro-10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(5-methyl-1-tritylimidazol-4-yl)methyl] acetate |
|---|---|
| PubChem CID | 10349022 |
| Molecular Formula | C39H34ClN3O3 |
| Molecular Weight | 628.17 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | [(2-chloro-10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(5-methyl-1-tritylimidazol-4-yl)methyl] acetate |
| SMILES | CC(=O)OC(c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1C)C1CCc2c(C)c3cc(Cl)ccc3n2C1=O |
| InChI | InChI=1S/C39H34ClN3O3/c1-25-33-23-31(40)19-21-35(33)43-34(25)22-20-32(38(43)45)37(46-27(3)44)36-26(2)42(24-41-36)39(28-13-7-4-8-14-28,29-15-9-5-10-16-29)30-17-11-6-12-18-30/h4-19,21,23-24,32,37H,20,22H2,1-3H3 |
| InChIKey | OFPFUDXCZJNZHU-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.17 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|