C13H22N2O2 — CID 103490226
3-(1-ethoxypropan-2-yloxymethyl)-N-ethylpyridin-2-amine (PubChem CID 103490226) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(1-ethoxypropan-2-yloxymethyl)-N-ethylpyridin-2-amine.
| Compound Name | 3-(1-ethoxypropan-2-yloxymethyl)-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 103490226 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-(1-ethoxypropan-2-yloxymethyl)-N-ethylpyridin-2-amine |
| SMILES | CCNc1ncccc1COC(C)COCC |
| InChI | InChI=1S/C13H22N2O2/c1-4-14-13-12(7-6-8-15-13)10-17-11(3)9-16-5-2/h6-8,11H,4-5,9-10H2,1-3H3,(H,14,15) |
| InChIKey | PDGYPXBKJRMQPI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |