C12H21NO3 — CID 103490685
[4-(1-ethoxypropan-2-yloxymethyl)-5-methylfuran-2-yl]methanamine (PubChem CID 103490685) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is [4-(1-ethoxypropan-2-yloxymethyl)-5-methylfuran-2-yl]methanamine.
| Compound Name | [4-(1-ethoxypropan-2-yloxymethyl)-5-methylfuran-2-yl]methanamine |
|---|---|
| PubChem CID | 103490685 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [4-(1-ethoxypropan-2-yloxymethyl)-5-methylfuran-2-yl]methanamine |
| SMILES | CCOCC(C)OCc1cc(CN)oc1C |
| InChI | InChI=1S/C12H21NO3/c1-4-14-7-9(2)15-8-11-5-12(6-13)16-10(11)3/h5,9H,4,6-8,13H2,1-3H3 |
| InChIKey | VNTFVWYJLAGMMT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |