C39H40N2O6 — CID 10349095
(3R,4S)-1-benzyl-4-[(4S,5S)-5-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10349095) has the molecular formula C39H40N2O6 and a molecular weight of 632.76 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-[(4S,5S)-5-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4S)-1-benzyl-4-[(4S,5S)-5-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10349095 |
| Molecular Formula | C39H40N2O6 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | (3R,4S)-1-benzyl-4-[(4S,5S)-5-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one |
| SMILES | CC1(C)O[C@@H]([C@H]2[C@@H](OCc3ccccc3)C(=O)N2Cc2ccccc2)[C@H]([C@H]2[C@@H](OCc3ccccc3)C(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C39H40N2O6/c1-39(2)46-33(31-35(44-25-29-19-11-5-12-20-29)37(42)40(31)23-27-15-7-3-8-16-27)34(47-39)32-36(45-26-30-21-13-6-14-22-30)38(43)41(32)24-28-17-9-4-10-18-28/h3-22,31-36H,23-26H2,1-2H3/t31-,32-,33-,34-,35+,36+/m0/s1 |
| InChIKey | VAGHVGPJQGFVMO-GFWDPPTMSA-N |
| XLogP | 5.50 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |