About 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane
2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane (PubChem CID 103491314) has the molecular formula C13H25ClO2
and a molecular weight of 248.79 g/mol. Its IUPAC name is 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane.
Molecular Properties
| Compound Name | 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane |
| PubChem CID | 103491314 |
| Molecular Formula | C13H25ClO2 |
| Molecular Weight | 248.79 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane |
| SMILES | CCOCC(C)OC1CC(Cl)C1(CC)CC |
| InChI | InChI=1S/C13H25ClO2/c1-5-13(6-2)11(14)8-12(13)16-10(4)9-15-7-3/h10-12H,5-9H2,1-4H3 |
| InChIKey | QZNMVPXVOWXCDS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane?
The IUPAC name of 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane (CID 103491314) is 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane.
What is the SMILES notation for 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane?
The canonical SMILES for 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane is CCOCC(C)OC1CC(Cl)C1(CC)CC.
What is the InChIKey of 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane?
The InChIKey is QZNMVPXVOWXCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25ClO2/c1-5-13(6-2)11(14)8-12(13)16-10(4)9-15-7-3/h10-12H,5-9H2,1-4H3.
What are the key properties of 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane?
2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane has a molecular weight of 248.79 g/mol, XLogP of 3.61, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1-ethoxypropan-2-yloxy)-1,1-diethylcyclobutane is sourced from PubChem (CID 103491314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).