C28H25F3O8S3 — CID 10349198
[(2S,4aR,6R,7S,8R,8aS)-6-[2,2-bis(phenylsulfanyl)acetyl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate (PubChem CID 10349198) has the molecular formula C28H25F3O8S3 and a molecular weight of 642.70 g/mol. Its IUPAC name is [(2S,4aR,6R,7S,8R,8aS)-6-[2,2-bis(phenylsulfanyl)acetyl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,4aR,6R,7S,8R,8aS)-6-[2,2-bis(phenylsulfanyl)acetyl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10349198 |
| Molecular Formula | C28H25F3O8S3 |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.07 |
| IUPAC Name | [(2S,4aR,6R,7S,8R,8aS)-6-[2,2-bis(phenylsulfanyl)acetyl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
| SMILES | O=C(C(Sc1ccccc1)Sc1ccccc1)[C@@H]1O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1O |
| InChI | InChI=1S/C28H25F3O8S3/c29-28(30,31)42(34,35)39-25-21(32)24(37-20-16-36-26(38-23(20)25)17-10-4-1-5-11-17)22(33)27(40-18-12-6-2-7-13-18)41-19-14-8-3-9-15-19/h1-15,20-21,23-27,32H,16H2/t20-,21+,23+,24-,25-,26+/m1/s1 |
| InChIKey | VSFJINWFNUPRAO-MQPZTCMQSA-N |
| XLogP | 4.94 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|