C10H16BrN3O2 — CID 103492286
methyl 2-bromo-3-[2-(2-methylimidazol-1-yl)ethylamino]propanoate (PubChem CID 103492286) has the molecular formula C10H16BrN3O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is methyl 2-bromo-3-[2-(2-methylimidazol-1-yl)ethylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[2-(2-methylimidazol-1-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 103492286 |
| Molecular Formula | C10H16BrN3O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl 2-bromo-3-[2-(2-methylimidazol-1-yl)ethylamino]propanoate |
| SMILES | COC(=O)C(Br)CNCCn1ccnc1C |
| InChI | InChI=1S/C10H16BrN3O2/c1-8-13-4-6-14(8)5-3-12-7-9(11)10(15)16-2/h4,6,9,12H,3,5,7H2,1-2H3 |
| InChIKey | MBMHLCZUQVNSLR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|