C25H23N7O10S2 — CID 10349233
N-[1,3-bis(cyclopropylmethyl)-2,6-dioxo-7H-purin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide (PubChem CID 10349233) has the molecular formula C25H23N7O10S2 and a molecular weight of 645.63 g/mol. Its IUPAC name is N-[1,3-bis(cyclopropylmethyl)-2,6-dioxo-7H-purin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide.
| Compound Name | N-[1,3-bis(cyclopropylmethyl)-2,6-dioxo-7H-purin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 10349233 |
| Molecular Formula | C25H23N7O10S2 |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 645.09 |
| IUPAC Name | N-[1,3-bis(cyclopropylmethyl)-2,6-dioxo-7H-purin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide |
| SMILES | O=c1c2[nH]c(N(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)nc2n(CC2CC2)c(=O)n1CC1CC1 |
| InChI | InChI=1S/C25H23N7O10S2/c33-23-21-22(28(13-15-1-2-15)25(34)29(23)14-16-3-4-16)27-24(26-21)32(43(39,40)19-9-5-17(6-10-19)30(35)36)44(41,42)20-11-7-18(8-12-20)31(37)38/h5-12,15-16H,1-4,13-14H2,(H,26,27) |
| InChIKey | CUTNSPCPJMHGQC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 230.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|