C30H28F6N4O6 — CID 10349323
benzyl N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-5-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]-3-pyridinyl]carbamate (PubChem CID 10349323) has the molecular formula C30H28F6N4O6 and a molecular weight of 654.56 g/mol. Its IUPAC name is benzyl N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-5-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]-3-pyridinyl]carbamate.
| Compound Name | benzyl N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-5-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 10349323 |
| Molecular Formula | C30H28F6N4O6 |
| Molecular Weight | 654.56 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | benzyl N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-5-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]-3-pyridinyl]carbamate |
| SMILES | CC(C)C(NC(=O)Cn1cc(Cc2cccc(NC(=O)C(F)(F)F)c2)cc(NC(=O)OCc2ccccc2)c1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C30H28F6N4O6/c1-17(2)24(25(42)29(31,32)33)39-23(41)15-40-14-20(11-19-9-6-10-21(12-19)37-27(44)30(34,35)36)13-22(26(40)43)38-28(45)46-16-18-7-4-3-5-8-18/h3-10,12-14,17,24H,11,15-16H2,1-2H3,(H,37,44)(H,38,45)(H,39,41) |
| InChIKey | VYNFCOWRNSUDCE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |