C11H8F14I2 — CID 10349398
3,3,4,4,5,5,6,6,7,7,8-undecafluoro-1,10-diiodo-8-(trifluoromethyl)decane (PubChem CID 10349398) has the molecular formula C11H8F14I2 and a molecular weight of 659.96 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-1,10-diiodo-8-(trifluoromethyl)decane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-1,10-diiodo-8-(trifluoromethyl)decane |
|---|---|
| PubChem CID | 10349398 |
| Molecular Formula | C11H8F14I2 |
| Molecular Weight | 659.96 g/mol |
| Exact Mass | 659.85 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-1,10-diiodo-8-(trifluoromethyl)decane |
| SMILES | FC(F)(F)C(F)(CCI)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
| InChI | InChI=1S/C11H8F14I2/c12-5(1-3-26,11(23,24)25)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)2-4-27/h1-4H2 |
| InChIKey | LGNWCZXTLIGTBG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.96 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|