About 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine
2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine (PubChem CID 103494447) has the molecular formula C15H23FN2O2
and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine.
Molecular Properties
| Compound Name | 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine |
| PubChem CID | 103494447 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine |
| SMILES | COC(CC(C)(CN)N1CCc2ccc(F)cc21)OC |
| InChI | InChI=1S/C15H23FN2O2/c1-15(10-17,9-14(19-2)20-3)18-7-6-11-4-5-12(16)8-13(11)18/h4-5,8,14H,6-7,9-10,17H2,1-3H3 |
| InChIKey | PCJQEOPTPUWVDN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine?
The IUPAC name of 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine (CID 103494447) is 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine.
What is the SMILES notation for 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine?
The canonical SMILES for 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine is COC(CC(C)(CN)N1CCc2ccc(F)cc21)OC.
What is the InChIKey of 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine?
The InChIKey is PCJQEOPTPUWVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2O2/c1-15(10-17,9-14(19-2)20-3)18-7-6-11-4-5-12(16)8-13(11)18/h4-5,8,14H,6-7,9-10,17H2,1-3H3.
What are the key properties of 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine?
2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine has a molecular weight of 282.36 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine is sourced from PubChem (CID 103494447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).