C15H23FN2O2 — CID 103494447
2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine (PubChem CID 103494447) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine.
| Compound Name | 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 103494447 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydroindol-1-yl)-4,4-dimethoxy-2-methylbutan-1-amine |
| SMILES | COC(CC(C)(CN)N1CCc2ccc(F)cc21)OC |
| InChI | InChI=1S/C15H23FN2O2/c1-15(10-17,9-14(19-2)20-3)18-7-6-11-4-5-12(16)8-13(11)18/h4-5,8,14H,6-7,9-10,17H2,1-3H3 |
| InChIKey | PCJQEOPTPUWVDN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|