C31H39F5N4O7 — CID 10349541
[(E)-1,1,1,2,2-pentafluoro-5-methyl-4-[[(2S)-1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]hex-3-en-3-yl] acetate (PubChem CID 10349541) has the molecular formula C31H39F5N4O7 and a molecular weight of 674.66 g/mol. Its IUPAC name is [(E)-1,1,1,2,2-pentafluoro-5-methyl-4-[[(2S)-1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]hex-3-en-3-yl] acetate.
| Compound Name | [(E)-1,1,1,2,2-pentafluoro-5-methyl-4-[[(2S)-1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]hex-3-en-3-yl] acetate |
|---|---|
| PubChem CID | 10349541 |
| Molecular Formula | C31H39F5N4O7 |
| Molecular Weight | 674.66 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | [(E)-1,1,1,2,2-pentafluoro-5-methyl-4-[[(2S)-1-[(2S)-3-methyl-2-[[4-(morpholine-4-carbonyl)benzoyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]hex-3-en-3-yl] acetate |
| SMILES | CC(=O)O/C(=C(/NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)c1ccc(C(=O)N2CCOCC2)cc1)C(C)C)C(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H39F5N4O7/c1-17(2)23(25(47-19(5)41)30(32,33)31(34,35)36)37-27(43)22-7-6-12-40(22)29(45)24(18(3)4)38-26(42)20-8-10-21(11-9-20)28(44)39-13-15-46-16-14-39/h8-11,17-18,22,24H,6-7,12-16H2,1-5H3,(H,37,43)(H,38,42)/b25-23+/t22-,24-/m0/s1 |
| InChIKey | AXFWXPZNJYBYIS-FREDPBAWSA-N |
| XLogP | 3.65 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|