C41H55F2N3O3 — CID 10349557
1-[4-[3,5-ditert-butyl-4-[2-(dimethylamino)ethoxy]benzoyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one (PubChem CID 10349557) has the molecular formula C41H55F2N3O3 and a molecular weight of 675.91 g/mol. Its IUPAC name is 1-[4-[3,5-ditert-butyl-4-[2-(dimethylamino)ethoxy]benzoyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one.
| Compound Name | 1-[4-[3,5-ditert-butyl-4-[2-(dimethylamino)ethoxy]benzoyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one |
|---|---|
| PubChem CID | 10349557 |
| Molecular Formula | C41H55F2N3O3 |
| Molecular Weight | 675.91 g/mol |
| Exact Mass | 675.42 |
| IUPAC Name | 1-[4-[3,5-ditert-butyl-4-[2-(dimethylamino)ethoxy]benzoyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one |
| SMILES | CN(C)CCOc1c(C(C)(C)C)cc(C(=O)N2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1C(C)(C)C |
| InChI | InChI=1S/C41H55F2N3O3/c1-40(2,3)35-27-31(28-36(41(4,5)6)38(35)49-26-25-44(7)8)39(48)46-23-21-45(22-24-46)37(47)12-10-9-11-34(29-13-17-32(42)18-14-29)30-15-19-33(43)20-16-30/h13-20,27-28,34H,9-12,21-26H2,1-8H3 |
| InChIKey | AOHLSLQKXPWNJV-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.91 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|