4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid

C12H23NO3 — CID 103495920

IUPAC4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid
SMILESCCC(C)N(CC)C(=O)C(C)C(C)C(=O)O
InChIInChI=1S/C12H23NO3/c1-6-8(3)13(7-2)11(14)9(4)10(5)12(15)16/h8-10H,6-7H2,1-5H3,(H,15,16)
InChIKeyXHFVYVONZJABSX-UHFFFAOYSA-N
MW229.32 g/mol
LogP1.99
Rot. Bonds6

About 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid

4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103495920) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103495920
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Name4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid
SMILESCCC(C)N(CC)C(=O)C(C)C(C)C(=O)O
InChIInChI=1S/C12H23NO3/c1-6-8(3)13(7-2)11(14)9(4)10(5)12(15)16/h8-10H,6-7H2,1-5H3,(H,15,16)
InChIKeyXHFVYVONZJABSX-UHFFFAOYSA-N
XLogP1.99
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 51.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid (CID 103495920) is 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid is CCC(C)N(CC)C(=O)C(C)C(C)C(=O)O.
What is the InChIKey of 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is XHFVYVONZJABSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-6-8(3)13(7-2)11(14)9(4)10(5)12(15)16/h8-10H,6-7H2,1-5H3,(H,15,16).
What are the key properties of 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 229.32 g/mol, XLogP of 1.99, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103495920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).