C12H23NO3 — CID 103495920
4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103495920) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103495920 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 4-[butan-2-yl(ethyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CCC(C)N(CC)C(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C12H23NO3/c1-6-8(3)13(7-2)11(14)9(4)10(5)12(15)16/h8-10H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | XHFVYVONZJABSX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |