About 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole
6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole (PubChem CID 103496394) has the molecular formula C14H19FN2
and a molecular weight of 234.32 g/mol. Its IUPAC name is 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole.
Molecular Properties
| Compound Name | 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole |
| PubChem CID | 103496394 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole |
| SMILES | CC1CC(N2CCc3ccc(F)cc32)CCN1 |
| InChI | InChI=1S/C14H19FN2/c1-10-8-13(4-6-16-10)17-7-5-11-2-3-12(15)9-14(11)17/h2-3,9-10,13,16H,4-8H2,1H3 |
| InChIKey | GPEFTGRZKJMTBF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole?
The IUPAC name of 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole (CID 103496394) is 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole.
What is the SMILES notation for 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole?
The canonical SMILES for 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole is CC1CC(N2CCc3ccc(F)cc32)CCN1.
What is the InChIKey of 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole?
The InChIKey is GPEFTGRZKJMTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2/c1-10-8-13(4-6-16-10)17-7-5-11-2-3-12(15)9-14(11)17/h2-3,9-10,13,16H,4-8H2,1H3.
What are the key properties of 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole?
6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole has a molecular weight of 234.32 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-(2-methylpiperidin-4-yl)-2,3-dihydroindole is sourced from PubChem (CID 103496394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).