C16H20N2O3 — CID 103496413
4-[2-(1H-indol-3-yl)ethylamino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103496413) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)ethylamino]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[2-(1H-indol-3-yl)ethylamino]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103496413 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)ethylamino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H20N2O3/c1-10(11(2)16(20)21)15(19)17-8-7-12-9-18-14-6-4-3-5-13(12)14/h3-6,9-11,18H,7-8H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | GYNGLSPQTSYRSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |