C24H24F6N6O6S3 — CID 10349792
4-[3-[2-amino-4-(diaminomethylideneamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10349792) has the molecular formula C24H24F6N6O6S3 and a molecular weight of 702.68 g/mol. Its IUPAC name is 4-[3-[2-amino-4-(diaminomethylideneamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[3-[2-amino-4-(diaminomethylideneamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10349792 |
| Molecular Formula | C24H24F6N6O6S3 |
| Molecular Weight | 702.68 g/mol |
| Exact Mass | 702.08 |
| IUPAC Name | 4-[3-[2-amino-4-(diaminomethylideneamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3c(C)cc(N=C(N)N)cc3N)c2)c(SC)s1 |
| InChI | InChI=1S/C20H22N6O2S3.2C2HF3O2/c1-10-6-12(26-20(24)25)8-14(21)17(10)11-4-3-5-13(7-11)31(27,28)16-9-15(18(22)23)30-19(16)29-2;2*3-2(4,5)1(6)7/h3-9H,21H2,1-2H3,(H3,22,23)(H4,24,25,26);2*(H,6,7) |
| InChIKey | UHAYFACGPOOBAS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 249.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|