2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid

C15H21NO4 — CID 103498262

IUPAC2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid
SMILESCCCOc1ccc(NC(=O)C(C)C(C)C(=O)O)cc1
InChIInChI=1S/C15H21NO4/c1-4-9-20-13-7-5-12(6-8-13)16-14(17)10(2)11(3)15(18)19/h5-8,10-11H,4,9H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyAXODKQMLCDMORC-UHFFFAOYSA-N
MW279.34 g/mol
LogP2.77
Rot. Bonds7

About 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid

2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid (PubChem CID 103498262) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid.

Molecular Properties

Compound Name2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid
PubChem CID103498262
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Name2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid
SMILESCCCOc1ccc(NC(=O)C(C)C(C)C(=O)O)cc1
InChIInChI=1S/C15H21NO4/c1-4-9-20-13-7-5-12(6-8-13)16-14(17)10(2)11(3)15(18)19/h5-8,10-11H,4,9H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyAXODKQMLCDMORC-UHFFFAOYSA-N
XLogP2.77
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 52.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid?
The IUPAC name of 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid (CID 103498262) is 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid.
What is the SMILES notation for 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid?
The canonical SMILES for 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid is CCCOc1ccc(NC(=O)C(C)C(C)C(=O)O)cc1.
What is the InChIKey of 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid?
The InChIKey is AXODKQMLCDMORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-4-9-20-13-7-5-12(6-8-13)16-14(17)10(2)11(3)15(18)19/h5-8,10-11H,4,9H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid?
2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid has a molecular weight of 279.34 g/mol, XLogP of 2.77, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-oxo-4-(4-propoxyanilino)butanoic acid is sourced from PubChem (CID 103498262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).