About 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid
4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498428) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
| PubChem CID | 103498428 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)N(C)CC1CCCC1 |
| InChI | InChI=1S/C13H23NO3/c1-9(10(2)13(16)17)12(15)14(3)8-11-6-4-5-7-11/h9-11H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | JOJIPJOKHYYREN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid (CID 103498428) is 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid is CC(C(=O)O)C(C)C(=O)N(C)CC1CCCC1.
What is the InChIKey of 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is JOJIPJOKHYYREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-9(10(2)13(16)17)12(15)14(3)8-11-6-4-5-7-11/h9-11H,4-8H2,1-3H3,(H,16,17).
What are the key properties of 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid?
4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 241.33 g/mol, XLogP of 1.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclopentylmethyl(methyl)amino]-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103498428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).