C15H23N3O3 — CID 103500492
5-methyl-3-[(4-propan-2-ylpiperidine-1-carbonyl)amino]-1H-pyrrole-2-carboxylic acid (PubChem CID 103500492) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-methyl-3-[(4-propan-2-ylpiperidine-1-carbonyl)amino]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-methyl-3-[(4-propan-2-ylpiperidine-1-carbonyl)amino]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 103500492 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 5-methyl-3-[(4-propan-2-ylpiperidine-1-carbonyl)amino]-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)N2CCC(C(C)C)CC2)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C15H23N3O3/c1-9(2)11-4-6-18(7-5-11)15(21)17-12-8-10(3)16-13(12)14(19)20/h8-9,11,16H,4-7H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | OGLGDNCYBCQTHM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |