C41H52N6O7 — CID 10350053
1,3-bis[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]urea (PubChem CID 10350053) has the molecular formula C41H52N6O7 and a molecular weight of 740.90 g/mol. Its IUPAC name is 1,3-bis[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]urea.
| Compound Name | 1,3-bis[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]urea |
|---|---|
| PubChem CID | 10350053 |
| Molecular Formula | C41H52N6O7 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | 1,3-bis[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]urea |
| SMILES | COc1ccccc1N1CCN(CC(O)COc2ccccc2NC(=O)Nc2ccccc2OCC(O)CN2CCN(c3ccccc3OC)CC2)CC1 |
| InChI | InChI=1S/C41H52N6O7/c1-51-39-17-9-5-13-35(39)46-23-19-44(20-24-46)27-31(48)29-53-37-15-7-3-11-33(37)42-41(50)43-34-12-4-8-16-38(34)54-30-32(49)28-45-21-25-47(26-22-45)36-14-6-10-18-40(36)52-2/h3-18,31-32,48-49H,19-30H2,1-2H3,(H2,42,43,50) |
| InChIKey | GIROKLPOXJKNQU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |