C14H18N2O2 — CID 103500756
1-[4-(1-aminoethyl)phenyl]-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 103500756) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)phenyl]-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1-aminoethyl)phenyl]-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 103500756 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-[4-(1-aminoethyl)phenyl]-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC(N)c1ccc(N2C(=O)C(C)C(C)C2=O)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-8-9(2)14(18)16(13(8)17)12-6-4-11(5-7-12)10(3)15/h4-10H,15H2,1-3H3 |
| InChIKey | BMHFGXDJBQXGOL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|