C19H23I3N2O6 — CID 10350150
(1-ethoxy-1-oxohexan-2-yl) 3,5-diacetamido-2,4,6-triiodobenzoate (PubChem CID 10350150) has the molecular formula C19H23I3N2O6 and a molecular weight of 756.11 g/mol. Its IUPAC name is (1-ethoxy-1-oxohexan-2-yl) 3,5-diacetamido-2,4,6-triiodobenzoate.
| Compound Name | (1-ethoxy-1-oxohexan-2-yl) 3,5-diacetamido-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 10350150 |
| Molecular Formula | C19H23I3N2O6 |
| Molecular Weight | 756.11 g/mol |
| Exact Mass | 755.87 |
| IUPAC Name | (1-ethoxy-1-oxohexan-2-yl) 3,5-diacetamido-2,4,6-triiodobenzoate |
| SMILES | CCCCC(OC(=O)c1c(I)c(NC(C)=O)c(I)c(NC(C)=O)c1I)C(=O)OCC |
| InChI | InChI=1S/C19H23I3N2O6/c1-5-7-8-11(18(27)29-6-2)30-19(28)12-13(20)16(23-9(3)25)15(22)17(14(12)21)24-10(4)26/h11H,5-8H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | NHXWCCDZCMBFDO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.11 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|