C17H30N4 — CID 103503036
N-[[4-methyl-2-(4-propan-2-ylpiperidin-1-yl)pyrimidin-5-yl]methyl]propan-1-amine (PubChem CID 103503036) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is N-[[4-methyl-2-(4-propan-2-ylpiperidin-1-yl)pyrimidin-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-methyl-2-(4-propan-2-ylpiperidin-1-yl)pyrimidin-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103503036 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | N-[[4-methyl-2-(4-propan-2-ylpiperidin-1-yl)pyrimidin-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(N2CCC(C(C)C)CC2)nc1C |
| InChI | InChI=1S/C17H30N4/c1-5-8-18-11-16-12-19-17(20-14(16)4)21-9-6-15(7-10-21)13(2)3/h12-13,15,18H,5-11H2,1-4H3 |
| InChIKey | PTOLDMXLOOEFAQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|