C24H17NO5 — CID 1035034
phenacyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1035034) has the molecular formula C24H17NO5 and a molecular weight of 399.40 g/mol. Its IUPAC name is phenacyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | phenacyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1035034 |
| Molecular Formula | C24H17NO5 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | phenacyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)OCC(=O)c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C24H17NO5/c1-15-7-5-6-10-20(15)25-22(27)18-12-11-17(13-19(18)23(25)28)24(29)30-14-21(26)16-8-3-2-4-9-16/h2-13H,14H2,1H3 |
| InChIKey | BZRSLHDEGJRQEM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|