C51H53N3O11 — CID 10350709
2-N,5-N-bis[(E)-2-(4-methoxyphenyl)ethenyl]-1-[2-(4-methoxyphenyl)ethyl]-3,4-bis(3,4,5-trimethoxyphenyl)pyrrole-2,5-dicarboxamide (PubChem CID 10350709) has the molecular formula C51H53N3O11 and a molecular weight of 884.00 g/mol. Its IUPAC name is 2-N,5-N-bis[(E)-2-(4-methoxyphenyl)ethenyl]-1-[2-(4-methoxyphenyl)ethyl]-3,4-bis(3,4,5-trimethoxyphenyl)pyrrole-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(E)-2-(4-methoxyphenyl)ethenyl]-1-[2-(4-methoxyphenyl)ethyl]-3,4-bis(3,4,5-trimethoxyphenyl)pyrrole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 10350709 |
| Molecular Formula | C51H53N3O11 |
| Molecular Weight | 884.00 g/mol |
| Exact Mass | 883.37 |
| IUPAC Name | 2-N,5-N-bis[(E)-2-(4-methoxyphenyl)ethenyl]-1-[2-(4-methoxyphenyl)ethyl]-3,4-bis(3,4,5-trimethoxyphenyl)pyrrole-2,5-dicarboxamide |
| SMILES | COc1ccc(/C=C/NC(=O)c2c(-c3cc(OC)c(OC)c(OC)c3)c(-c3cc(OC)c(OC)c(OC)c3)c(C(=O)N/C=C/c3ccc(OC)cc3)n2CCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C51H53N3O11/c1-57-37-16-10-32(11-17-37)22-25-52-50(55)46-44(35-28-40(60-4)48(64-8)41(29-35)61-5)45(36-30-42(62-6)49(65-9)43(31-36)63-7)47(54(46)27-24-34-14-20-39(59-3)21-15-34)51(56)53-26-23-33-12-18-38(58-2)19-13-33/h10-23,25-26,28-31H,24,27H2,1-9H3,(H,52,55)(H,53,56)/b25-22+,26-23+ |
| InChIKey | XULSZCSDRGODLO-FXMCMDAWSA-N |
| XLogP | 8.94 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.00 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |