C15H16BrN3OS — CID 103507889
3-amino-5-[(3-bromophenyl)methylamino]-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 103507889) has the molecular formula C15H16BrN3OS and a molecular weight of 366.28 g/mol. Its IUPAC name is 3-amino-5-[(3-bromophenyl)methylamino]-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(3-bromophenyl)methylamino]-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507889 |
| Molecular Formula | C15H16BrN3OS |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-amino-5-[(3-bromophenyl)methylamino]-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(NCc2cccc(Br)c2)cc1N |
| InChI | InChI=1S/C15H16BrN3OS/c1-2-6-18-15(20)14-12(17)8-13(21-14)19-9-10-4-3-5-11(16)7-10/h2-5,7-8,19H,1,6,9,17H2,(H,18,20) |
| InChIKey | PQMNLCFBLJTHJR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|