C13H14N4O2S2 — CID 103509183
3-amino-5-[methyl(pyridin-3-ylmethyl)amino]-4-methylsulfonylthiophene-2-carbonitrile (PubChem CID 103509183) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 3-amino-5-[methyl(pyridin-3-ylmethyl)amino]-4-methylsulfonylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[methyl(pyridin-3-ylmethyl)amino]-4-methylsulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103509183 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-amino-5-[methyl(pyridin-3-ylmethyl)amino]-4-methylsulfonylthiophene-2-carbonitrile |
| SMILES | CN(Cc1cccnc1)c1sc(C#N)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C13H14N4O2S2/c1-17(8-9-4-3-5-16-7-9)13-12(21(2,18)19)11(15)10(6-14)20-13/h3-5,7H,8,15H2,1-2H3 |
| InChIKey | OHMUSIGZMLQBIS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |