C9H8ClN5O — CID 103512448
N-(6-chloropyridazin-3-yl)-3-methylimidazole-4-carboxamide (PubChem CID 103512448) has the molecular formula C9H8ClN5O and a molecular weight of 237.65 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(6-chloropyridazin-3-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103512448 |
| Molecular Formula | C9H8ClN5O |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C9H8ClN5O/c1-15-5-11-4-6(15)9(16)12-8-3-2-7(10)13-14-8/h2-5H,1H3,(H,12,14,16) |
| InChIKey | WASPSDDKCTWIIM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |