3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid

C10H15F2NO4 — CID 103513308

IUPAC3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid
SMILESO=C(O)CCOC1CCN(C(=O)C(F)F)CC1
InChIInChI=1S/C10H15F2NO4/c11-9(12)10(16)13-4-1-7(2-5-13)17-6-3-8(14)15/h7,9H,1-6H2,(H,14,15)
InChIKeyYZTJWQYCSYIYBM-UHFFFAOYSA-N
MW251.23 g/mol
LogP0.73
Rot. Bonds5

About 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid

3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid (PubChem CID 103513308) has the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. Its IUPAC name is 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid.

Molecular Properties

Compound Name3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid
PubChem CID103513308
Molecular FormulaC10H15F2NO4
Molecular Weight251.23 g/mol
Exact Mass251.10
IUPAC Name3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid
SMILESO=C(O)CCOC1CCN(C(=O)C(F)F)CC1
InChIInChI=1S/C10H15F2NO4/c11-9(12)10(16)13-4-1-7(2-5-13)17-6-3-8(14)15/h7,9H,1-6H2,(H,14,15)
InChIKeyYZTJWQYCSYIYBM-UHFFFAOYSA-N
XLogP0.73
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.23
LogP ≤ 50.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid?
The IUPAC name of 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid (CID 103513308) is 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid.
What is the SMILES notation for 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid?
The canonical SMILES for 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid is O=C(O)CCOC1CCN(C(=O)C(F)F)CC1.
What is the InChIKey of 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid?
The InChIKey is YZTJWQYCSYIYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO4/c11-9(12)10(16)13-4-1-7(2-5-13)17-6-3-8(14)15/h7,9H,1-6H2,(H,14,15).
What are the key properties of 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid?
3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid has a molecular weight of 251.23 g/mol, XLogP of 0.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxypropanoic acid is sourced from PubChem (CID 103513308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).