5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid

C8H13F2NO3 — CID 103513451

IUPAC5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid
SMILESCC(CCC(=O)O)CNC(=O)C(F)F
InChIInChI=1S/C8H13F2NO3/c1-5(2-3-6(12)13)4-11-8(14)7(9)10/h5,7H,2-4H2,1H3,(H,11,14)(H,12,13)
InChIKeyIEUXLZOPNQILHC-UHFFFAOYSA-N
MW209.19 g/mol
LogP0.87
Rot. Bonds6

About 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid

5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid (PubChem CID 103513451) has the molecular formula C8H13F2NO3 and a molecular weight of 209.19 g/mol. Its IUPAC name is 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid.

Molecular Properties

Compound Name5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid
PubChem CID103513451
Molecular FormulaC8H13F2NO3
Molecular Weight209.19 g/mol
Exact Mass209.09
IUPAC Name5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid
SMILESCC(CCC(=O)O)CNC(=O)C(F)F
InChIInChI=1S/C8H13F2NO3/c1-5(2-3-6(12)13)4-11-8(14)7(9)10/h5,7H,2-4H2,1H3,(H,11,14)(H,12,13)
InChIKeyIEUXLZOPNQILHC-UHFFFAOYSA-N
XLogP0.87
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.19
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid?
The IUPAC name of 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid (CID 103513451) is 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid.
What is the SMILES notation for 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid?
The canonical SMILES for 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid is CC(CCC(=O)O)CNC(=O)C(F)F.
What is the InChIKey of 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid?
The InChIKey is IEUXLZOPNQILHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO3/c1-5(2-3-6(12)13)4-11-8(14)7(9)10/h5,7H,2-4H2,1H3,(H,11,14)(H,12,13).
What are the key properties of 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid?
5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid has a molecular weight of 209.19 g/mol, XLogP of 0.87, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid is sourced from PubChem (CID 103513451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).