C8H13F2NO3 — CID 103513451
5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid (PubChem CID 103513451) has the molecular formula C8H13F2NO3 and a molecular weight of 209.19 g/mol. Its IUPAC name is 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid.
| Compound Name | 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103513451 |
| Molecular Formula | C8H13F2NO3 |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 5-[(2,2-difluoroacetyl)amino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNC(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO3/c1-5(2-3-6(12)13)4-11-8(14)7(9)10/h5,7H,2-4H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | IEUXLZOPNQILHC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |