About 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone
1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone (PubChem CID 103513702) has the molecular formula C12H11F2NO
and a molecular weight of 223.22 g/mol. Its IUPAC name is 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone |
| PubChem CID | 103513702 |
| Molecular Formula | C12H11F2NO |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone |
| SMILES | Cc1ccc2c(C(=O)C(F)F)cn(C)c2c1 |
| InChI | InChI=1S/C12H11F2NO/c1-7-3-4-8-9(11(16)12(13)14)6-15(2)10(8)5-7/h3-6,12H,1-2H3 |
| InChIKey | QEMAXDFEBBBJNM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone (CID 103513702) is 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone is Cc1ccc2c(C(=O)C(F)F)cn(C)c2c1.
What is the InChIKey of 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone?
The InChIKey is QEMAXDFEBBBJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2NO/c1-7-3-4-8-9(11(16)12(13)14)6-15(2)10(8)5-7/h3-6,12H,1-2H3.
What are the key properties of 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone?
1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone has a molecular weight of 223.22 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,6-dimethylindol-3-yl)-2,2-difluoroethanone is sourced from PubChem (CID 103513702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).