About N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide
N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide (PubChem CID 103513780) has the molecular formula C6H4F2N4O
and a molecular weight of 186.12 g/mol. Its IUPAC name is N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide |
| PubChem CID | 103513780 |
| Molecular Formula | C6H4F2N4O |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)C(F)F |
| InChI | InChI=1S/C6H4F2N4O/c7-4(8)6(13)11-5-3(1-9)2-10-12-5/h2,4H,(H2,10,11,12,13) |
| InChIKey | ZYFZVTBENMUTBN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide?
The IUPAC name of N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide (CID 103513780) is N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide.
What is the SMILES notation for N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide?
The canonical SMILES for N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide is N#Cc1cn[nH]c1NC(=O)C(F)F.
What is the InChIKey of N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide?
The InChIKey is ZYFZVTBENMUTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2N4O/c7-4(8)6(13)11-5-3(1-9)2-10-12-5/h2,4H,(H2,10,11,12,13).
What are the key properties of N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide?
N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide has a molecular weight of 186.12 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-1H-pyrazol-5-yl)-2,2-difluoroacetamide is sourced from PubChem (CID 103513780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).