C11H13F2NO3 — CID 103513891
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2,2-difluoroacetamide (PubChem CID 103513891) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2,2-difluoroacetamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103513891 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2,2-difluoroacetamide |
| SMILES | CCOc1ccc(NC(=O)C(F)F)cc1CO |
| InChI | InChI=1S/C11H13F2NO3/c1-2-17-9-4-3-8(5-7(9)6-15)14-11(16)10(12)13/h3-5,10,15H,2,6H2,1H3,(H,14,16) |
| InChIKey | BYDRXVPMKAPPHL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |