C6H7F2N3O — CID 103514034
2,2-difluoro-N-(1H-pyrazol-5-ylmethyl)acetamide (PubChem CID 103514034) has the molecular formula C6H7F2N3O and a molecular weight of 175.14 g/mol. Its IUPAC name is 2,2-difluoro-N-(1H-pyrazol-5-ylmethyl)acetamide.
| Compound Name | 2,2-difluoro-N-(1H-pyrazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 103514034 |
| Molecular Formula | C6H7F2N3O |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2,2-difluoro-N-(1H-pyrazol-5-ylmethyl)acetamide |
| SMILES | O=C(NCc1ccn[nH]1)C(F)F |
| InChI | InChI=1S/C6H7F2N3O/c7-5(8)6(12)9-3-4-1-2-10-11-4/h1-2,5H,3H2,(H,9,12)(H,10,11) |
| InChIKey | YKGGCCZLKDZEDG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |