About N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide (PubChem CID 103514217) has the molecular formula C8H12F2N2O2
and a molecular weight of 206.19 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide |
| PubChem CID | 103514217 |
| Molecular Formula | C8H12F2N2O2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide |
| SMILES | NC1C2CCOC2C1NC(=O)C(F)F |
| InChI | InChI=1S/C8H12F2N2O2/c9-7(10)8(13)12-5-4(11)3-1-2-14-6(3)5/h3-7H,1-2,11H2,(H,12,13) |
| InChIKey | IKDURNDVIIFCKT-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide?
The IUPAC name of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide (CID 103514217) is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide.
What is the SMILES notation for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide?
The canonical SMILES for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide is NC1C2CCOC2C1NC(=O)C(F)F.
What is the InChIKey of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide?
The InChIKey is IKDURNDVIIFCKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O2/c9-7(10)8(13)12-5-4(11)3-1-2-14-6(3)5/h3-7H,1-2,11H2,(H,12,13).
What are the key properties of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide?
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide has a molecular weight of 206.19 g/mol, XLogP of -0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2,2-difluoroacetamide is sourced from PubChem (CID 103514217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).