About methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate
methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate (PubChem CID 103514323) has the molecular formula C6H9F2NO3
and a molecular weight of 181.14 g/mol. Its IUPAC name is methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate |
| PubChem CID | 103514323 |
| Molecular Formula | C6H9F2NO3 |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)C(F)F |
| InChI | InChI=1S/C6H9F2NO3/c1-9(3-4(10)12-2)6(11)5(7)8/h5H,3H2,1-2H3 |
| InChIKey | FVOOMHDTLVCTRX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate?
The IUPAC name of methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate (CID 103514323) is methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate.
What is the SMILES notation for methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate?
The canonical SMILES for methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate is COC(=O)CN(C)C(=O)C(F)F.
What is the InChIKey of methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate?
The InChIKey is FVOOMHDTLVCTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO3/c1-9(3-4(10)12-2)6(11)5(7)8/h5H,3H2,1-2H3.
What are the key properties of methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate?
methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate has a molecular weight of 181.14 g/mol, XLogP of -0.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,2-difluoroacetyl)-methylamino]acetate is sourced from PubChem (CID 103514323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).