C9H8ClF3O — CID 103514435
2-(1-chloro-2,2-difluoroethyl)-4-fluoro-1-methoxybenzene (PubChem CID 103514435) has the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. Its IUPAC name is 2-(1-chloro-2,2-difluoroethyl)-4-fluoro-1-methoxybenzene.
| Compound Name | 2-(1-chloro-2,2-difluoroethyl)-4-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 103514435 |
| Molecular Formula | C9H8ClF3O |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-(1-chloro-2,2-difluoroethyl)-4-fluoro-1-methoxybenzene |
| SMILES | COc1ccc(F)cc1C(Cl)C(F)F |
| InChI | InChI=1S/C9H8ClF3O/c1-14-7-3-2-5(11)4-6(7)8(10)9(12)13/h2-4,8-9H,1H3 |
| InChIKey | XSFQHTPIXIFPMS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|