C11H12Br2F2O2 — CID 103514667
2-bromo-4-(1-bromo-2,2-difluoroethyl)-1-(2-methoxyethoxy)benzene (PubChem CID 103514667) has the molecular formula C11H12Br2F2O2 and a molecular weight of 374.02 g/mol. Its IUPAC name is 2-bromo-4-(1-bromo-2,2-difluoroethyl)-1-(2-methoxyethoxy)benzene.
| Compound Name | 2-bromo-4-(1-bromo-2,2-difluoroethyl)-1-(2-methoxyethoxy)benzene |
|---|---|
| PubChem CID | 103514667 |
| Molecular Formula | C11H12Br2F2O2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | 2-bromo-4-(1-bromo-2,2-difluoroethyl)-1-(2-methoxyethoxy)benzene |
| SMILES | COCCOc1ccc(C(Br)C(F)F)cc1Br |
| InChI | InChI=1S/C11H12Br2F2O2/c1-16-4-5-17-9-3-2-7(6-8(9)12)10(13)11(14)15/h2-3,6,10-11H,4-5H2,1H3 |
| InChIKey | MDMSVCNPHHXVNH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|