About 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide
2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (PubChem CID 103514962) has the molecular formula C12H17F2NO
and a molecular weight of 229.27 g/mol. Its IUPAC name is 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
Molecular Properties
| Compound Name | 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| PubChem CID | 103514962 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| SMILES | O=C(NC1CC2CC1C1CCCC21)C(F)F |
| InChI | InChI=1S/C12H17F2NO/c13-11(14)12(16)15-10-5-6-4-9(10)8-3-1-2-7(6)8/h6-11H,1-5H2,(H,15,16) |
| InChIKey | DGEBZTBNCPTNHC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The IUPAC name of 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (CID 103514962) is 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
What is the SMILES notation for 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The canonical SMILES for 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide is O=C(NC1CC2CC1C1CCCC21)C(F)F.
What is the InChIKey of 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The InChIKey is DGEBZTBNCPTNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2NO/c13-11(14)12(16)15-10-5-6-4-9(10)8-3-1-2-7(6)8/h6-11H,1-5H2,(H,15,16).
What are the key properties of 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide has a molecular weight of 229.27 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide is sourced from PubChem (CID 103514962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).