C8H13F2NO2 — CID 103515326
1-(2,5-dimethylmorpholin-4-yl)-2,2-difluoroethanone (PubChem CID 103515326) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is 1-(2,5-dimethylmorpholin-4-yl)-2,2-difluoroethanone.
| Compound Name | 1-(2,5-dimethylmorpholin-4-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 103515326 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(2,5-dimethylmorpholin-4-yl)-2,2-difluoroethanone |
| SMILES | CC1CN(C(=O)C(F)F)C(C)CO1 |
| InChI | InChI=1S/C8H13F2NO2/c1-5-4-13-6(2)3-11(5)8(12)7(9)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | RNXOZHIAXTYMAX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |