About 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone
1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone (PubChem CID 103515351) has the molecular formula C6H9F2NO3S
and a molecular weight of 213.20 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone |
| PubChem CID | 103515351 |
| Molecular Formula | C6H9F2NO3S |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C6H9F2NO3S/c7-5(8)6(10)9-1-3-13(11,12)4-2-9/h5H,1-4H2 |
| InChIKey | QRFGEXRJOBYCOW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone (CID 103515351) is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone is O=C(C(F)F)N1CCS(=O)(=O)CC1.
What is the InChIKey of 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone?
The InChIKey is QRFGEXRJOBYCOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO3S/c7-5(8)6(10)9-1-3-13(11,12)4-2-9/h5H,1-4H2.
What are the key properties of 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone?
1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone has a molecular weight of 213.20 g/mol, XLogP of -0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-difluoroethanone is sourced from PubChem (CID 103515351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).