About N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide
N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide (PubChem CID 103515645) has the molecular formula C8H10F2N2OS
and a molecular weight of 220.24 g/mol. Its IUPAC name is N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide |
| PubChem CID | 103515645 |
| Molecular Formula | C8H10F2N2OS |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide |
| SMILES | CCc1nc(NC(=O)C(F)F)sc1C |
| InChI | InChI=1S/C8H10F2N2OS/c1-3-5-4(2)14-8(11-5)12-7(13)6(9)10/h6H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | GYWCBQSFGRSUJX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide?
The IUPAC name of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide (CID 103515645) is N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide.
What is the SMILES notation for N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide?
The canonical SMILES for N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide is CCc1nc(NC(=O)C(F)F)sc1C.
What is the InChIKey of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide?
The InChIKey is GYWCBQSFGRSUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2OS/c1-3-5-4(2)14-8(11-5)12-7(13)6(9)10/h6H,3H2,1-2H3,(H,11,12,13).
What are the key properties of N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide?
N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide has a molecular weight of 220.24 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide is sourced from PubChem (CID 103515645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).