C9H16F2N2O — CID 103515649
2,2-difluoro-N-[(1-methylpiperidin-3-yl)methyl]acetamide (PubChem CID 103515649) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,2-difluoro-N-[(1-methylpiperidin-3-yl)methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[(1-methylpiperidin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 103515649 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2,2-difluoro-N-[(1-methylpiperidin-3-yl)methyl]acetamide |
| SMILES | CN1CCCC(CNC(=O)C(F)F)C1 |
| InChI | InChI=1S/C9H16F2N2O/c1-13-4-2-3-7(6-13)5-12-9(14)8(10)11/h7-8H,2-6H2,1H3,(H,12,14) |
| InChIKey | BBHKCWWHJTUIEQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |